C20H27FN2O2 — CID 71929508
[1-(3-fluorophenyl)cyclobutyl]-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 71929508) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is [1-(3-fluorophenyl)cyclobutyl]-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(3-fluorophenyl)cyclobutyl]-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71929508 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [1-(3-fluorophenyl)cyclobutyl]-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCC(CN2CCOCC2)C1)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C20H27FN2O2/c21-18-4-1-3-17(13-18)20(6-2-7-20)19(24)23-8-5-16(15-23)14-22-9-11-25-12-10-22/h1,3-4,13,16H,2,5-12,14-15H2 |
| InChIKey | GIPXSXOOHVRLKH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |