C20H26FNO2 — CID 71976708
1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl-[4-(3-fluorophenyl)oxan-4-yl]methanone (PubChem CID 71976708) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl-[4-(3-fluorophenyl)oxan-4-yl]methanone.
| Compound Name | 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl-[4-(3-fluorophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 71976708 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl-[4-(3-fluorophenyl)oxan-4-yl]methanone |
| SMILES | O=C(N1CC2CCCCC2C1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C20H26FNO2/c21-18-7-3-6-17(12-18)20(8-10-24-11-9-20)19(23)22-13-15-4-1-2-5-16(15)14-22/h3,6-7,12,15-16H,1-2,4-5,8-11,13-14H2 |
| InChIKey | XKQLZTBEDAGYSY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |