C18H24ClFN2O2 — CID 120658609
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride (PubChem CID 120658609) has the molecular formula C18H24ClFN2O2 and a molecular weight of 354.85 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120658609 |
| Molecular Formula | C18H24ClFN2O2 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(N1C[C@H]2CNC[C@H]2C1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C18H23FN2O2.ClH/c19-16-3-1-2-15(8-16)18(4-6-23-7-5-18)17(22)21-11-13-9-20-10-14(13)12-21;/h1-3,8,13-14,20H,4-7,9-12H2;1H/t13-,14+; |
| InChIKey | MOXOSAMOLMOLRC-KAECKJJSSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |