C19H24FNO3 — CID 97077235
[4-(3-fluorophenyl)oxan-4-yl]-[(5S)-2-oxa-7-azaspiro[4.4]nonan-7-yl]methanone (PubChem CID 97077235) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is [4-(3-fluorophenyl)oxan-4-yl]-[(5S)-2-oxa-7-azaspiro[4.4]nonan-7-yl]methanone.
| Compound Name | [4-(3-fluorophenyl)oxan-4-yl]-[(5S)-2-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
|---|---|
| PubChem CID | 97077235 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [4-(3-fluorophenyl)oxan-4-yl]-[(5S)-2-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
| SMILES | O=C(N1CC[C@]2(CCOC2)C1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C19H24FNO3/c20-16-3-1-2-15(12-16)19(6-10-23-11-7-19)17(22)21-8-4-18(13-21)5-9-24-14-18/h1-3,12H,4-11,13-14H2/t18-/m0/s1 |
| InChIKey | IXQQSUTVQJDOMY-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |