C16H17F2NO3 — CID 119259632
3-fluoro-1-[1-(3-fluorophenyl)cyclobutanecarbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 119259632) has the molecular formula C16H17F2NO3 and a molecular weight of 309.31 g/mol. Its IUPAC name is 3-fluoro-1-[1-(3-fluorophenyl)cyclobutanecarbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-[1-(3-fluorophenyl)cyclobutanecarbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259632 |
| Molecular Formula | C16H17F2NO3 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-fluoro-1-[1-(3-fluorophenyl)cyclobutanecarbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(F)CCN(C(=O)C2(c3cccc(F)c3)CCC2)C1 |
| InChI | InChI=1S/C16H17F2NO3/c17-12-4-1-3-11(9-12)15(5-2-6-15)13(20)19-8-7-16(18,10-19)14(21)22/h1,3-4,9H,2,5-8,10H2,(H,21,22) |
| InChIKey | PQPUEWCAVWGGDM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |