C26H33FN2O2 — CID 55538682
[4-(adamantane-1-carbonyl)piperazin-1-yl]-[1-(3-fluorophenyl)cyclobutyl]methanone (PubChem CID 55538682) has the molecular formula C26H33FN2O2 and a molecular weight of 424.56 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)piperazin-1-yl]-[1-(3-fluorophenyl)cyclobutyl]methanone.
| Compound Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-[1-(3-fluorophenyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 55538682 |
| Molecular Formula | C26H33FN2O2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-[1-(3-fluorophenyl)cyclobutyl]methanone |
| SMILES | O=C(N1CCN(C(=O)C2(c3cccc(F)c3)CCC2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H33FN2O2/c27-22-4-1-3-21(14-22)26(5-2-6-26)24(31)29-9-7-28(8-10-29)23(30)25-15-18-11-19(16-25)13-20(12-18)17-25/h1,3-4,14,18-20H,2,5-13,15-17H2 |
| InChIKey | IRTWGVHZBFWFPI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |