C18H25FN2O2 — CID 95606984
[1-(3-fluorophenyl)cyclobutyl]-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95606984) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is [1-(3-fluorophenyl)cyclobutyl]-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone.
| Compound Name | [1-(3-fluorophenyl)cyclobutyl]-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95606984 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | [1-(3-fluorophenyl)cyclobutyl]-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | C[C@@H](O)CN1CCN(C(=O)C2(c3cccc(F)c3)CCC2)CC1 |
| InChI | InChI=1S/C18H25FN2O2/c1-14(22)13-20-8-10-21(11-9-20)17(23)18(6-3-7-18)15-4-2-5-16(19)12-15/h2,4-5,12,14,22H,3,6-11,13H2,1H3/t14-/m1/s1 |
| InChIKey | UUSROVNEXHCUNB-CQSZACIVSA-N |
| XLogP | 1.77 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |