C20H27FN2O — CID 71938226
[1-(3-fluorophenyl)cyclobutyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 71938226) has the molecular formula C20H27FN2O and a molecular weight of 330.45 g/mol. Its IUPAC name is [1-(3-fluorophenyl)cyclobutyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(3-fluorophenyl)cyclobutyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 71938226 |
| Molecular Formula | C20H27FN2O |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | [1-(3-fluorophenyl)cyclobutyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(N1CCC(N2CCCC2)CC1)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C20H27FN2O/c21-17-6-3-5-16(15-17)20(9-4-10-20)19(24)23-13-7-18(8-14-23)22-11-1-2-12-22/h3,5-6,15,18H,1-2,4,7-14H2 |
| InChIKey | XMJSPCOJKGVQOK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |