C20H30ClFN2O — CID 119517548
[4-(1-aminoethyl)piperidin-1-yl]-[1-(3-fluorophenyl)cyclohexyl]methanone;hydrochloride (PubChem CID 119517548) has the molecular formula C20H30ClFN2O and a molecular weight of 368.92 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-[1-(3-fluorophenyl)cyclohexyl]methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-[1-(3-fluorophenyl)cyclohexyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119517548 |
| Molecular Formula | C20H30ClFN2O |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-[1-(3-fluorophenyl)cyclohexyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)C2(c3cccc(F)c3)CCCCC2)CC1.Cl |
| InChI | InChI=1S/C20H29FN2O.ClH/c1-15(22)16-8-12-23(13-9-16)19(24)20(10-3-2-4-11-20)17-6-5-7-18(21)14-17;/h5-7,14-16H,2-4,8-13,22H2,1H3;1H |
| InChIKey | HQFNGXUULMTNDE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |