C19H28BrClN2O — CID 119519076
[4-(1-aminoethyl)piperidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone;hydrochloride (PubChem CID 119519076) has the molecular formula C19H28BrClN2O and a molecular weight of 415.80 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119519076 |
| Molecular Formula | C19H28BrClN2O |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)C2(c3ccc(Br)cc3)CCCC2)CC1.Cl |
| InChI | InChI=1S/C19H27BrN2O.ClH/c1-14(21)15-8-12-22(13-9-15)18(23)19(10-2-3-11-19)16-4-6-17(20)7-5-16;/h4-7,14-15H,2-3,8-13,21H2,1H3;1H |
| InChIKey | BISPYJQYCYXJNS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |