C17H22BrNO2 — CID 55555458
[1-(4-bromophenyl)cyclobutyl]-(4-methoxypiperidin-1-yl)methanone (PubChem CID 55555458) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is [1-(4-bromophenyl)cyclobutyl]-(4-methoxypiperidin-1-yl)methanone.
| Compound Name | [1-(4-bromophenyl)cyclobutyl]-(4-methoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55555458 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [1-(4-bromophenyl)cyclobutyl]-(4-methoxypiperidin-1-yl)methanone |
| SMILES | COC1CCN(C(=O)C2(c3ccc(Br)cc3)CCC2)CC1 |
| InChI | InChI=1S/C17H22BrNO2/c1-21-15-7-11-19(12-8-15)16(20)17(9-2-10-17)13-3-5-14(18)6-4-13/h3-6,15H,2,7-12H2,1H3 |
| InChIKey | HZZBDSAEQALVAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |