C23H31BrN2O2 — CID 55554449
azepan-1-yl-[1-[1-(4-bromophenyl)cyclobutanecarbonyl]piperidin-4-yl]methanone (PubChem CID 55554449) has the molecular formula C23H31BrN2O2 and a molecular weight of 447.42 g/mol. Its IUPAC name is azepan-1-yl-[1-[1-(4-bromophenyl)cyclobutanecarbonyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[1-(4-bromophenyl)cyclobutanecarbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55554449 |
| Molecular Formula | C23H31BrN2O2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | azepan-1-yl-[1-[1-(4-bromophenyl)cyclobutanecarbonyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(C(=O)C2(c3ccc(Br)cc3)CCC2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C23H31BrN2O2/c24-20-8-6-19(7-9-20)23(12-5-13-23)22(28)26-16-10-18(11-17-26)21(27)25-14-3-1-2-4-15-25/h6-9,18H,1-5,10-17H2 |
| InChIKey | LCYJVKCAFOIBQT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |