C19H26ClNO2 — CID 134048238
[1-(3-chlorophenyl)cyclohexyl]-(4-methoxypiperidin-1-yl)methanone (PubChem CID 134048238) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is [1-(3-chlorophenyl)cyclohexyl]-(4-methoxypiperidin-1-yl)methanone.
| Compound Name | [1-(3-chlorophenyl)cyclohexyl]-(4-methoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 134048238 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [1-(3-chlorophenyl)cyclohexyl]-(4-methoxypiperidin-1-yl)methanone |
| SMILES | COC1CCN(C(=O)C2(c3cccc(Cl)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C19H26ClNO2/c1-23-17-8-12-21(13-9-17)18(22)19(10-3-2-4-11-19)15-6-5-7-16(20)14-15/h5-7,14,17H,2-4,8-13H2,1H3 |
| InChIKey | PHNQHPPJXYUBEE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |