C19H24ClNO4 — CID 119251972
1-[1-(3-chlorophenyl)cyclohexanecarbonyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251972) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)cyclohexanecarbonyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[1-(3-chlorophenyl)cyclohexanecarbonyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251972 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[1-(3-chlorophenyl)cyclohexanecarbonyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(O)CCN(C(=O)C2(c3cccc(Cl)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C19H24ClNO4/c20-15-6-4-5-14(13-15)18(7-2-1-3-8-18)16(22)21-11-9-19(25,10-12-21)17(23)24/h4-6,13,25H,1-3,7-12H2,(H,23,24) |
| InChIKey | VKHVTGJFAYOLAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |