C18H22ClNO5 — CID 119252081
1-[4-(3-chlorophenyl)oxane-4-carbonyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119252081) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)oxane-4-carbonyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[4-(3-chlorophenyl)oxane-4-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119252081 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[4-(3-chlorophenyl)oxane-4-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(O)CCN(C(=O)C2(c3cccc(Cl)c3)CCOCC2)CC1 |
| InChI | InChI=1S/C18H22ClNO5/c19-14-3-1-2-13(12-14)17(6-10-25-11-7-17)15(21)20-8-4-18(24,5-9-20)16(22)23/h1-3,12,24H,4-11H2,(H,22,23) |
| InChIKey | HUKLRFZLZJQIBD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |