C20H26ClNO4 — CID 124700302
3-[(3S)-1-[4-(3-chlorophenyl)oxane-4-carbonyl]piperidin-3-yl]propanoic acid (PubChem CID 124700302) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 3-[(3S)-1-[4-(3-chlorophenyl)oxane-4-carbonyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S)-1-[4-(3-chlorophenyl)oxane-4-carbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124700302 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[(3S)-1-[4-(3-chlorophenyl)oxane-4-carbonyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CC[C@@H]1CCCN(C(=O)C2(c3cccc(Cl)c3)CCOCC2)C1 |
| InChI | InChI=1S/C20H26ClNO4/c21-17-5-1-4-16(13-17)20(8-11-26-12-9-20)19(25)22-10-2-3-15(14-22)6-7-18(23)24/h1,4-5,13,15H,2-3,6-12,14H2,(H,23,24)/t15-/m0/s1 |
| InChIKey | ZTWGUGOMMHLZIH-HNNXBMFYSA-N |
| XLogP | 3.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |