C17H23BrN2O2 — CID 124593829
[(3S)-3-aminopiperidin-1-yl]-[4-(3-bromophenyl)oxan-4-yl]methanone (PubChem CID 124593829) has the molecular formula C17H23BrN2O2 and a molecular weight of 367.29 g/mol. Its IUPAC name is [(3S)-3-aminopiperidin-1-yl]-[4-(3-bromophenyl)oxan-4-yl]methanone.
| Compound Name | [(3S)-3-aminopiperidin-1-yl]-[4-(3-bromophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 124593829 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(3S)-3-aminopiperidin-1-yl]-[4-(3-bromophenyl)oxan-4-yl]methanone |
| SMILES | N[C@H]1CCCN(C(=O)C2(c3cccc(Br)c3)CCOCC2)C1 |
| InChI | InChI=1S/C17H23BrN2O2/c18-14-4-1-3-13(11-14)17(6-9-22-10-7-17)16(21)20-8-2-5-15(19)12-20/h1,3-4,11,15H,2,5-10,12,19H2/t15-/m0/s1 |
| InChIKey | QENIMCACZYLSMC-HNNXBMFYSA-N |
| XLogP | 2.45 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |