C16H22ClFN2O2 — CID 119409516
[(3R)-3-aminopyrrolidin-1-yl]-[4-(4-fluorophenyl)oxan-4-yl]methanone;hydrochloride (PubChem CID 119409516) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[4-(4-fluorophenyl)oxan-4-yl]methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-(4-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119409516 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-(4-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)C2(c3ccc(F)cc3)CCOCC2)C1 |
| InChI | InChI=1S/C16H21FN2O2.ClH/c17-13-3-1-12(2-4-13)16(6-9-21-10-7-16)15(20)19-8-5-14(18)11-19;/h1-4,14H,5-11,18H2;1H/t14-;/m1./s1 |
| InChIKey | GIVHKWUHCAZSLU-PFEQFJNWSA-N |
| XLogP | 1.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |