C17H24Cl2N2O — CID 119409853
[(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone;hydrochloride (PubChem CID 119409853) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119409853 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)C2(c3ccc(Cl)cc3)CCCCC2)C1 |
| InChI | InChI=1S/C17H23ClN2O.ClH/c18-14-6-4-13(5-7-14)17(9-2-1-3-10-17)16(21)20-11-8-15(19)12-20;/h4-7,15H,1-3,8-12,19H2;1H/t15-;/m1./s1 |
| InChIKey | RKVNCPQXKVWQMO-XFULWGLBSA-N |
| XLogP | 3.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |