C19H29ClN2O — CID 75495859
(3-aminopyrrolidin-1-yl)-[1-(4-propan-2-ylphenyl)cyclopentyl]methanone;hydrochloride (PubChem CID 75495859) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-[1-(4-propan-2-ylphenyl)cyclopentyl]methanone;hydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-[1-(4-propan-2-ylphenyl)cyclopentyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 75495859 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-[1-(4-propan-2-ylphenyl)cyclopentyl]methanone;hydrochloride |
| SMILES | CC(C)c1ccc(C2(C(=O)N3CCC(N)C3)CCCC2)cc1.Cl |
| InChI | InChI=1S/C19H28N2O.ClH/c1-14(2)15-5-7-16(8-6-15)19(10-3-4-11-19)18(22)21-12-9-17(20)13-21;/h5-8,14,17H,3-4,9-13,20H2,1-2H3;1H |
| InChIKey | SONABUYHJJVVMN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |