C18H26ClNO2 — CID 142125179
[1-(4-chlorophenyl)cyclobutyl]-(3-hydroxypiperidin-1-yl)methanone;ethane (PubChem CID 142125179) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclobutyl]-(3-hydroxypiperidin-1-yl)methanone;ethane.
| Compound Name | [1-(4-chlorophenyl)cyclobutyl]-(3-hydroxypiperidin-1-yl)methanone;ethane |
|---|---|
| PubChem CID | 142125179 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [1-(4-chlorophenyl)cyclobutyl]-(3-hydroxypiperidin-1-yl)methanone;ethane |
| SMILES | CC.O=C(N1CCCC(O)C1)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C16H20ClNO2.C2H6/c17-13-6-4-12(5-7-13)16(8-2-9-16)15(20)18-10-1-3-14(19)11-18;1-2/h4-7,14,19H,1-3,8-11H2;1-2H3 |
| InChIKey | ASMFCIMQVNFVQT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |