C18H23ClN2O — CID 70719580
[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1-(4-chlorophenyl)cyclobutyl]methanone (PubChem CID 70719580) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1-(4-chlorophenyl)cyclobutyl]methanone.
| Compound Name | [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1-(4-chlorophenyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 70719580 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1-(4-chlorophenyl)cyclobutyl]methanone |
| SMILES | CN1CC[C@H]2CN(C(=O)C3(c4ccc(Cl)cc4)CCC3)C[C@H]21 |
| InChI | InChI=1S/C18H23ClN2O/c1-20-10-7-13-11-21(12-16(13)20)17(22)18(8-2-9-18)14-3-5-15(19)6-4-14/h3-6,13,16H,2,7-12H2,1H3/t13-,16+/m0/s1 |
| InChIKey | ZBGUOSNLJSIHET-XJKSGUPXSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |