C19H25ClN2O2 — CID 126810716
[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone (PubChem CID 126810716) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone.
| Compound Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 126810716 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone |
| SMILES | CN1C[C@@H]2CN(C(=O)C3(c4ccc(Cl)cc4)CCOCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-21-10-14-12-22(13-15(14)11-21)18(23)19(6-8-24-9-7-19)16-2-4-17(20)5-3-16/h2-5,14-15H,6-13H2,1H3/t14-,15+ |
| InChIKey | ZEMGIWJMVCOHBB-GASCZTMLSA-N |
| XLogP | 2.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |