C25H28ClNO3 — CID 110138732
[(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone (PubChem CID 110138732) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone.
| Compound Name | [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 110138732 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(4-chlorophenyl)oxan-4-yl]methanone |
| SMILES | O=C(N1C[C@@H]2CC[C@H](Oc3ccccc3)[C@@H]2C1)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C25H28ClNO3/c26-20-9-7-19(8-10-20)25(12-14-29-15-13-25)24(28)27-16-18-6-11-23(22(18)17-27)30-21-4-2-1-3-5-21/h1-5,7-10,18,22-23H,6,11-17H2/t18-,22+,23-/m0/s1 |
| InChIKey | PFTOGXYZFPRBCU-NMNUPHIUSA-N |
| XLogP | 4.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |