C23H26ClNO3 — CID 100685329
4-(4-chlorophenyl)-N-(4-cyclopentyloxyphenyl)oxane-4-carboxamide (PubChem CID 100685329) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(4-cyclopentyloxyphenyl)oxane-4-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-(4-cyclopentyloxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 100685329 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(4-cyclopentyloxyphenyl)oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C23H26ClNO3/c24-18-7-5-17(6-8-18)23(13-15-27-16-14-23)22(26)25-19-9-11-21(12-10-19)28-20-3-1-2-4-20/h5-12,20H,1-4,13-16H2,(H,25,26) |
| InChIKey | UYMXZHRVDCPNRU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |