C22H24ClNO2S — CID 100781332
1-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide (PubChem CID 100781332) has the molecular formula C22H24ClNO2S and a molecular weight of 401.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100781332 |
| Molecular Formula | C22H24ClNO2S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CSC2)cc1)C1(c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C22H24ClNO2S/c23-17-6-4-16(5-7-17)22(12-2-1-3-13-22)21(25)24-18-8-10-19(11-9-18)26-20-14-27-15-20/h4-11,20H,1-3,12-15H2,(H,24,25) |
| InChIKey | GVEBFDRHTIYGAR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |