C22H25NO2S — CID 100781195
1-phenyl-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide (PubChem CID 100781195) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 1-phenyl-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-phenyl-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100781195 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-phenyl-N-[4-(thietan-3-yloxy)phenyl]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CSC2)cc1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H25NO2S/c24-21(22(13-5-2-6-14-22)17-7-3-1-4-8-17)23-18-9-11-19(12-10-18)25-20-15-26-16-20/h1,3-4,7-12,20H,2,5-6,13-16H2,(H,23,24) |
| InChIKey | FXDZNGNSPQIXKO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |