C21H22ClNO3S — CID 100781359
4-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]oxane-4-carboxamide (PubChem CID 100781359) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 100781359 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-(thietan-3-yloxy)phenyl]oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CSC2)cc1)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C21H22ClNO3S/c22-16-3-1-15(2-4-16)21(9-11-25-12-10-21)20(24)23-17-5-7-18(8-6-17)26-19-13-27-14-19/h1-8,19H,9-14H2,(H,23,24) |
| InChIKey | GSXSSLSUCCPQEP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |