C26H30ClNO4 — CID 125015462
[4-(4-chlorophenyl)oxan-4-yl]-[(3R)-3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 125015462) has the molecular formula C26H30ClNO4 and a molecular weight of 455.98 g/mol. Its IUPAC name is [4-(4-chlorophenyl)oxan-4-yl]-[(3R)-3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | [4-(4-chlorophenyl)oxan-4-yl]-[(3R)-3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 125015462 |
| Molecular Formula | C26H30ClNO4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [4-(4-chlorophenyl)oxan-4-yl]-[(3R)-3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(N1CCC2(CC1)C[C@@H](Oc1ccccc1)CO2)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C26H30ClNO4/c27-21-8-6-20(7-9-21)26(12-16-30-17-13-26)24(29)28-14-10-25(11-15-28)18-23(19-31-25)32-22-4-2-1-3-5-22/h1-9,23H,10-19H2/t23-/m1/s1 |
| InChIKey | WTUPFGIUEIPKKM-HSZRJFAPSA-N |
| XLogP | 4.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |