C25H28ClN3O2 — CID 126466606
[(4aR,8aR)-1-[1-(4-chlorophenyl)cyclobutanecarbonyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone (PubChem CID 126466606) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is [(4aR,8aR)-1-[1-(4-chlorophenyl)cyclobutanecarbonyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone.
| Compound Name | [(4aR,8aR)-1-[1-(4-chlorophenyl)cyclobutanecarbonyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 126466606 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [(4aR,8aR)-1-[1-(4-chlorophenyl)cyclobutanecarbonyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CC[C@@H]2[C@H](CCCN2C(=O)C2(c3ccc(Cl)cc3)CCC2)C1 |
| InChI | InChI=1S/C25H28ClN3O2/c26-21-6-4-20(5-7-21)25(11-2-12-25)24(31)29-15-1-3-19-17-28(16-10-22(19)29)23(30)18-8-13-27-14-9-18/h4-9,13-14,19,22H,1-3,10-12,15-17H2/t19-,22-/m1/s1 |
| InChIKey | YIBHTIRTBHZHBU-DENIHFKCSA-N |
| XLogP | 4.31 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |