C23H26ClN3O — CID 56853951
[(4aR,8aR)-1-[(Z)-2-chloro-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone (PubChem CID 56853951) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is [(4aR,8aR)-1-[(Z)-2-chloro-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone.
| Compound Name | [(4aR,8aR)-1-[(Z)-2-chloro-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 56853951 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(4aR,8aR)-1-[(Z)-2-chloro-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CC[C@@H]2[C@H](CCCN2C/C(Cl)=C/c2ccccc2)C1 |
| InChI | InChI=1S/C23H26ClN3O/c24-21(15-18-5-2-1-3-6-18)17-26-13-4-7-20-16-27(14-10-22(20)26)23(28)19-8-11-25-12-9-19/h1-3,5-6,8-9,11-12,15,20,22H,4,7,10,13-14,16-17H2/b21-15-/t20-,22-/m1/s1 |
| InChIKey | GGZWEIBVIPAYQT-PYBGETDBSA-N |
| XLogP | 4.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |