C10H12N2O2 — CID 62917595
(3-hydroxypyrrolidin-1-yl)-pyridin-4-ylmethanone (PubChem CID 62917595) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl)-pyridin-4-ylmethanone.
| Compound Name | (3-hydroxypyrrolidin-1-yl)-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 62917595 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl)-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCC(O)C1 |
| InChI | InChI=1S/C10H12N2O2/c13-9-3-6-12(7-9)10(14)8-1-4-11-5-2-8/h1-2,4-5,9,13H,3,6-7H2 |
| InChIKey | LKVOPULTKCQUEP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |