C11H11Cl2NO2 — CID 66261191
(3,4-dichlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 66261191) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 66261191 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (3,4-dichlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H11Cl2NO2/c12-9-2-1-7(5-10(9)13)11(16)14-4-3-8(15)6-14/h1-2,5,8,15H,3-4,6H2/t8-/m1/s1 |
| InChIKey | LDESWGJZRIRNQH-MRVPVSSYSA-N |
| XLogP | 2.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |