C11H11BrClNO2 — CID 81002096
(4-bromo-3-chlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 81002096) has the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (4-bromo-3-chlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 81002096 |
| Molecular Formula | C11H11BrClNO2 |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)c(Cl)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H11BrClNO2/c12-9-2-1-7(5-10(9)13)11(16)14-4-3-8(15)6-14/h1-2,5,8,15H,3-4,6H2/t8-/m1/s1 |
| InChIKey | QGNOYEWFXYMJBG-MRVPVSSYSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |