C18H27N3O — CID 124689542
(2S)-1-[(4aS,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-aminopropan-1-one (PubChem CID 124689542) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (2S)-1-[(4aS,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-aminopropan-1-one.
| Compound Name | (2S)-1-[(4aS,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-aminopropan-1-one |
|---|---|
| PubChem CID | 124689542 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (2S)-1-[(4aS,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-aminopropan-1-one |
| SMILES | C[C@H](N)C(=O)N1CC[C@@H]2[C@@H](CCCN2Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O/c1-14(19)18(22)21-11-9-17-16(13-21)8-5-10-20(17)12-15-6-3-2-4-7-15/h2-4,6-7,14,16-17H,5,8-13,19H2,1H3/t14-,16-,17+/m0/s1 |
| InChIKey | ICTMLYJRBZTMGN-BHYGNILZSA-N |
| XLogP | 1.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |