C12H24ClN3O — CID 120873110
(2R)-2-amino-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propan-1-one;hydrochloride (PubChem CID 120873110) has the molecular formula C12H24ClN3O and a molecular weight of 261.80 g/mol. Its IUPAC name is (2R)-2-amino-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120873110 |
| Molecular Formula | C12H24ClN3O |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (2R)-2-amino-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propan-1-one;hydrochloride |
| SMILES | C[C@@H](N)C(=O)N1CCC2C(CCCN2C)C1.Cl |
| InChI | InChI=1S/C12H23N3O.ClH/c1-9(13)12(16)15-7-5-11-10(8-15)4-3-6-14(11)2;/h9-11H,3-8,13H2,1-2H3;1H/t9-,10?,11?;/m1./s1 |
| InChIKey | GYJCASDWJCDTIW-XRUJYBCYSA-N |
| XLogP | 0.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |