C16H29N3O — CID 116656880
(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 116656880) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(3-methylpiperidin-1-yl)methanone.
| Compound Name | (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 116656880 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)N2CCC3C(CCCN3C)C2)C1 |
| InChI | InChI=1S/C16H29N3O/c1-13-5-3-9-18(11-13)16(20)19-10-7-15-14(12-19)6-4-8-17(15)2/h13-15H,3-12H2,1-2H3 |
| InChIKey | AVPVGZUCULAUHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |