C14H26N2OS — CID 107033002
3-methyl-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-sulfanylbutan-1-one (PubChem CID 107033002) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 3-methyl-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-sulfanylbutan-1-one.
| Compound Name | 3-methyl-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 107033002 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-methyl-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-sulfanylbutan-1-one |
| SMILES | CC(C)C(S)C(=O)N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C14H26N2OS/c1-10(2)13(18)14(17)16-8-6-12-11(9-16)5-4-7-15(12)3/h10-13,18H,4-9H2,1-3H3 |
| InChIKey | CLNHGFVGOSEXNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|