C11H18ClFN2O — CID 167816390
2-chloro-2-fluoro-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanone (PubChem CID 167816390) has the molecular formula C11H18ClFN2O and a molecular weight of 248.73 g/mol. Its IUPAC name is 2-chloro-2-fluoro-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanone.
| Compound Name | 2-chloro-2-fluoro-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanone |
|---|---|
| PubChem CID | 167816390 |
| Molecular Formula | C11H18ClFN2O |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-chloro-2-fluoro-1-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)ethanone |
| SMILES | CN1CCCC2CN(C(=O)C(F)Cl)CCC21 |
| InChI | InChI=1S/C11H18ClFN2O/c1-14-5-2-3-8-7-15(6-4-9(8)14)11(16)10(12)13/h8-10H,2-7H2,1H3 |
| InChIKey | MXZUQLPMZXEKMY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|