C26H32N2O3 — CID 97062969
(2R)-1-[(4aR,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-acetylphenoxy)propan-1-one (PubChem CID 97062969) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is (2R)-1-[(4aR,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-acetylphenoxy)propan-1-one.
| Compound Name | (2R)-1-[(4aR,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-acetylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 97062969 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (2R)-1-[(4aR,8aR)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-acetylphenoxy)propan-1-one |
| SMILES | CC(=O)c1cccc(O[C@H](C)C(=O)N2CC[C@@H]3[C@H](CCCN3Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H32N2O3/c1-19(29)22-10-6-12-24(16-22)31-20(2)26(30)28-15-13-25-23(18-28)11-7-14-27(25)17-21-8-4-3-5-9-21/h3-6,8-10,12,16,20,23,25H,7,11,13-15,17-18H2,1-2H3/t20-,23-,25-/m1/s1 |
| InChIKey | FFYYNQPIBDUSQY-QFZRFWILSA-N |
| XLogP | 4.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |