C24H29FN2O — CID 97015516
1-[(4aS,8aS)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-(3-fluorophenyl)propan-1-one (PubChem CID 97015516) has the molecular formula C24H29FN2O and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[(4aS,8aS)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-(3-fluorophenyl)propan-1-one.
| Compound Name | 1-[(4aS,8aS)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-(3-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 97015516 |
| Molecular Formula | C24H29FN2O |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-[(4aS,8aS)-1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-(3-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1cccc(F)c1)N1CC[C@H]2[C@@H](CCCN2Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H29FN2O/c25-22-10-4-8-19(16-22)11-12-24(28)27-15-13-23-21(18-27)9-5-14-26(23)17-20-6-2-1-3-7-20/h1-4,6-8,10,16,21,23H,5,9,11-15,17-18H2/t21-,23-/m0/s1 |
| InChIKey | ZYUSPPWJCOHYAU-GMAHTHKFSA-N |
| XLogP | 4.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |