C18H24FNO3 — CID 86782835
2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-3-yl]-2-methylpropanoic acid (PubChem CID 86782835) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-3-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 86782835 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-3-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCCN(C(=O)CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H24FNO3/c1-18(2,17(22)23)14-6-4-10-20(12-14)16(21)9-8-13-5-3-7-15(19)11-13/h3,5,7,11,14H,4,6,8-10,12H2,1-2H3,(H,22,23) |
| InChIKey | PJERWQZEPDGDBF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |