C22H23FN4OS — CID 42451284
[(4aR,8aS)-1-(2,1,3-benzothiadiazol-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(3-fluorophenyl)methanone (PubChem CID 42451284) has the molecular formula C22H23FN4OS and a molecular weight of 410.52 g/mol. Its IUPAC name is [(4aR,8aS)-1-(2,1,3-benzothiadiazol-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(3-fluorophenyl)methanone.
| Compound Name | [(4aR,8aS)-1-(2,1,3-benzothiadiazol-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 42451284 |
| Molecular Formula | C22H23FN4OS |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(4aR,8aS)-1-(2,1,3-benzothiadiazol-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CC[C@H]2[C@H](CCCN2Cc2ccc3nsnc3c2)C1 |
| InChI | InChI=1S/C22H23FN4OS/c23-18-5-1-3-16(12-18)22(28)27-10-8-21-17(14-27)4-2-9-26(21)13-15-6-7-19-20(11-15)25-29-24-19/h1,3,5-7,11-12,17,21H,2,4,8-10,13-14H2/t17-,21+/m1/s1 |
| InChIKey | GAWHXMVDMCUJTM-UTKZUKDTSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |