C24H27FN2O3 — CID 42437006
1-[(4aR,8aR)-6-(3-methoxybenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 42437006) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-(3-methoxybenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aR)-6-(3-methoxybenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 42437006 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[(4aR,8aR)-6-(3-methoxybenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | COc1cccc(C(=O)N2CC[C@@H]3[C@H](CCCN3C(=O)Cc3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C24H27FN2O3/c1-30-21-9-3-6-18(15-21)24(29)26-12-10-22-19(16-26)7-4-11-27(22)23(28)14-17-5-2-8-20(25)13-17/h2-3,5-6,8-9,13,15,19,22H,4,7,10-12,14,16H2,1H3/t19-,22-/m1/s1 |
| InChIKey | CVOAOQCJMOPJKN-DENIHFKCSA-N |
| XLogP | 3.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |