C17H25N3O — CID 81199131
[3-(aminomethyl)phenyl]-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone (PubChem CID 81199131) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone.
| Compound Name | [3-(aminomethyl)phenyl]-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 81199131 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [3-(aminomethyl)phenyl]-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
| SMILES | CN1CCCC2CN(C(=O)c3cccc(CN)c3)CCC21 |
| InChI | InChI=1S/C17H25N3O/c1-19-8-3-6-15-12-20(9-7-16(15)19)17(21)14-5-2-4-13(10-14)11-18/h2,4-5,10,15-16H,3,6-9,11-12,18H2,1H3 |
| InChIKey | XENPFHUTCKPWST-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |