C18H29Cl2N3O2 — CID 154918447
[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[3-(aminomethyl)phenyl]methanone;dihydrochloride (PubChem CID 154918447) has the molecular formula C18H29Cl2N3O2 and a molecular weight of 390.36 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[3-(aminomethyl)phenyl]methanone;dihydrochloride.
| Compound Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[3-(aminomethyl)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 154918447 |
| Molecular Formula | C18H29Cl2N3O2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[3-(aminomethyl)phenyl]methanone;dihydrochloride |
| SMILES | CN1CCC[C@]2(CO)CCN(C(=O)c3cccc(CN)c3)C[C@@H]12.Cl.Cl |
| InChI | InChI=1S/C18H27N3O2.2ClH/c1-20-8-3-6-18(13-22)7-9-21(12-16(18)20)17(23)15-5-2-4-14(10-15)11-19;;/h2,4-5,10,16,22H,3,6-9,11-13,19H2,1H3;2*1H/t16-,18-;;/m1../s1 |
| InChIKey | GXCXYDAFJXUYNH-XMHBETNISA-N |
| XLogP | 1.91 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |