C22H33N3O3 — CID 135105249
[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3-methyl-4-morpholin-4-ylphenyl)methanone (PubChem CID 135105249) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3-methyl-4-morpholin-4-ylphenyl)methanone.
| Compound Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3-methyl-4-morpholin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 135105249 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3-methyl-4-morpholin-4-ylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O3/c1-17-14-18(4-5-19(17)24-10-12-28-13-11-24)21(27)25-9-7-22(16-26)6-3-8-23(2)20(22)15-25/h4-5,14,20,26H,3,6-13,15-16H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | ZGDCIKWOFKBSID-IFMALSPDSA-N |
| XLogP | 1.75 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |