C15H21ClN4O — CID 81200537
(2-amino-6-chloro-4-pyridinyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone (PubChem CID 81200537) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is (2-amino-6-chloro-4-pyridinyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (2-amino-6-chloro-4-pyridinyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 81200537 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2-amino-6-chloro-4-pyridinyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
| SMILES | CN1CCCC2CN(C(=O)c3cc(N)nc(Cl)c3)CCC21 |
| InChI | InChI=1S/C15H21ClN4O/c1-19-5-2-3-10-9-20(6-4-12(10)19)15(21)11-7-13(16)18-14(17)8-11/h7-8,10,12H,2-6,9H2,1H3,(H2,17,18) |
| InChIKey | HGZJGPLREKJHSR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|