C14H20N2O2 — CID 81206244
furan-2-yl-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone (PubChem CID 81206244) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is furan-2-yl-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone.
| Compound Name | furan-2-yl-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 81206244 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | furan-2-yl-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
| SMILES | CN1CCCC2CN(C(=O)c3ccco3)CCC21 |
| InChI | InChI=1S/C14H20N2O2/c1-15-7-2-4-11-10-16(8-6-12(11)15)14(17)13-5-3-9-18-13/h3,5,9,11-12H,2,4,6-8,10H2,1H3 |
| InChIKey | DZAYTVLOFAVRJW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |