C23H23N3O3 — CID 42432948
[(4aR,8aS)-6-(furan-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-quinolin-6-ylmethanone (PubChem CID 42432948) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(4aR,8aS)-6-(furan-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-quinolin-6-ylmethanone.
| Compound Name | [(4aR,8aS)-6-(furan-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 42432948 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(4aR,8aS)-6-(furan-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-quinolin-6-ylmethanone |
| SMILES | O=C(c1ccco1)N1CC[C@H]2[C@H](CCCN2C(=O)c2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C23H23N3O3/c27-22(17-7-8-19-16(14-17)4-1-10-24-19)26-11-2-5-18-15-25(12-9-20(18)26)23(28)21-6-3-13-29-21/h1,3-4,6-8,10,13-14,18,20H,2,5,9,11-12,15H2/t18-,20+/m1/s1 |
| InChIKey | AFCIGUJQKVPULI-QUCCMNQESA-N |
| XLogP | 3.59 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |